Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 (755) 3323-9182 ex 801 802 // +86 13424336463 | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com, | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Otava Ltd. | Ukraine | Inquire | ||
|---|---|---|---|---|
|
+380 (44) 522-2458 | |||
|
order@otavachemicals.com | |||
| Chemical manufacturer since 1997 | ||||
| Name | Ethyl 4-Amino-3,5-Dimethyl-1H-Pyrrole-2-Carboxylate |
|---|---|
| Synonyms | ethyl 4-amino-3,5-dimethyl-1H-pyrrole-2-carboxylate |
| Molecular Structure |  |
| Molecular Formula | C9H14N2O2 |
| Molecular Weight | 182.22 |
| CAS Registry Number | 100818-55-1 |
| SMILES | CCOC(=O)c1c(c(c([nH]1)C)N)C |
| InChI | 1S/C9H14N2O2/c1-4-13-9(12)8-5(2)7(10)6(3)11-8/h11H,4,10H2,1-3H3 |
| InChIKey | DGFSEXWPQMIHGW-UHFFFAOYSA-N |
| Density | 1.161g/cm3 (Cal.) |
|---|---|
| Boiling point | 347.184°C at 760 mmHg (Cal.) |
| Flash point | 163.771°C (Cal.) |
| Refractive index | 1.563 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Ethyl 4-Amino-3,5-Dimethyl-1H-Pyrrole-2-Carboxylate |